CAS 1004644-65-8
:3-Nitro-1H-pyrazole-1-propanoic acid hydrazide
Description:
3-Nitro-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity and reactivity due to the presence of the nitro group. The nitro group can influence the compound's polarity and solubility, while the hydrazide moiety may contribute to its ability to form hydrogen bonds, enhancing its interaction with biological targets. The compound may also display acidic properties due to the carboxylic acid component, which can affect its behavior in various chemical environments. Additionally, 3-Nitro-1H-pyrazole-1-propanoic acid hydrazide may be of interest in pharmaceutical research, particularly for its potential applications in drug development or as a reagent in organic synthesis. Its specific characteristics, including melting point, solubility, and stability, would depend on the conditions under which it is studied or utilized.
Formula:C6H9N5O3
InChI:InChI=1S/C6H9N5O3/c7-8-6(12)2-4-10-3-1-5(9-10)11(13)14/h1,3H,2,4,7H2,(H,8,12)
InChI key:InChIKey=ZEETWLHPCCIISF-UHFFFAOYSA-N
SMILES:C(CC(NN)=O)N1N=C(N(=O)=O)C=C1
Synonyms:- 1H-Pyrazole-1-propanoic acid, 3-nitro-, hydrazide
- 3-Nitro-1H-pyrazole-1-propanoic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.