CAS 10047-18-4
:5-ACETYL-1,2-DIHYDROACENAPHTHYLENE
Description:
5-Acetyl-1,2-dihydroacenaphthylene is an organic compound characterized by its fused ring structure, which includes both acenaphthylene and an acetyl functional group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of multiple conjugated double bonds within its structure. The acetyl group introduces a carbonyl functionality, which can influence its reactivity and solubility in various solvents. 5-Acetyl-1,2-dihydroacenaphthylene is often utilized in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its chemical behavior can be affected by factors such as temperature, pH, and the presence of other reagents. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact. Overall, this compound is of interest in both academic research and industrial applications due to its unique structural features and potential reactivity.
Formula:C14H12O
InChI:InChI=1/C14H12O/c1-9(15)12-8-7-11-6-5-10-3-2-4-13(12)14(10)11/h2-4,7-8H,5-6H2,1H3
SMILES:CC(=O)c1ccc2CCc3cccc1c23
Synonyms:- 1-Acenaphthen-5-Yl-Ethanone
- 1-(1,2-Dihydroacenaphthylen-5-Yl)Ethanone
- 5-Acetylacenaphthene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Acetylacenaphthene
CAS:Acenaphthene is a five-membered, isomeric, organometallic compound that has been shown to undergo dehydrogenation and acylation reactions. The catalytic reaction of acenaphthene with acid chloride in the presence of aluminum chloride yields 5-acetylacenaphthene. 5-Acetylacenaphthene has been synthesized by acetylating acenaphthylene with an acetyl halide in the presence of a base. The parameters for this process are the temperature and concentration of reactants. The cyclopentane ring can be observed in the nmr spectra for 5-acetylacenaphthene.Formula:C14H12OPurity:Min. 95%Molecular weight:196.24 g/mol


