CAS 1004727-40-5: 1,3-Dimethyl-6-(1,3,5-trimethyl-1H-pyrazol-4-yl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Description:1,3-Dimethyl-6-(1,3,5-trimethyl-1H-pyrazol-4-yl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a complex organic compound characterized by its multi-ring structure, which includes both pyrazole and pyridine moieties. This compound features multiple methyl groups, contributing to its lipophilicity and potentially influencing its biological activity. The presence of a carboxylic acid functional group suggests that it may exhibit acidic properties, which can affect its solubility and reactivity in various environments. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. Additionally, its unique arrangement of functional groups may allow for specific interactions with biological targets, making it a candidate for further research in drug discovery. As with many complex organic compounds, its synthesis, stability, and reactivity would be of interest in both academic and industrial settings.
Formula:C15H17N5O2
InChI:InChI=1S/C15H17N5O2/c1-7-12(9(3)19(4)17-7)11-6-10(15(21)22)13-8(2)18-20(5)14(13)16-11/h6H,1-5H3,(H,21,22)
InChI key:InChIKey=XNMQOSKUHAYISZ-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=NC2=C1C(=NN2C)C)C=3C(=NN(C3C)C)C
- Synonyms:
- 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1,3-dimethyl-6-(1,3,5-trimethyl-1H-pyrazol-4-yl)-
- 1,3-Dimethyl-6-(1,3,5-trimethyl-1H-pyrazol-4-yl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,3-Dimethyl-6-(1,3,5-trimethyl-1 H -pyrazol-4-yl)-1 H -pyrazolo[3,4- b ]pyridine-4-carboxylic acid REF: 10-F027718CAS: 1004727-40-5 | 95+% | 485.00 € | Thu 02 Oct 25 |

1,3-Dimethyl-6-(1,3,5-trimethyl-1 H -pyrazol-4-yl)-1 H -pyrazolo[3,4- b ]pyridine-4-carboxylic acid
Ref: 10-F027718
1g | 485.00 € |