CAS 1004727-44-9

5,7-Bis(1-methyl-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

5,7-Bis(1-methyl-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a complex organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates multiple pyrazole rings. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the 1-methyl-1H-pyrazole moieties enhances its biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmacological agent. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, possibly influencing enzyme activity or receptor binding. Its solubility, stability, and reactivity can be influenced by the presence of the carboxylic acid group and the overall electronic properties of the pyrazole and pyrimidine rings. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its applications may extend to research in drug development or as a biochemical probe.

Formula: C₁₅H₁₃N₇O₂

InChI: InChI=1S/C15H13N7O2/c1-20-11(3-5-16-20)9-7-13(12-4-6-17-21(12)2)22-14(18-9)8-10(19-22)15(23)24/h3-8H,1-2H3,(H,23,24)

InChI key: InChIKey=BFVRFHNGJVSAFQ-UHFFFAOYSA-N

SMILES: CN1C(C=2N3C(N=C(C2)C=4N(C)N=CC4)=CC(C(O)=O)=N3)=CC=N1

Synonyms:

• 5,7-Bis(1-methyl-1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 5,7-bis(1-methyl-1H-pyrazol-5-yl)-
• 5,7-bis(2-methylpyrazol-3-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

5,7-Bis-(2-methyl-2 H -pyrazol-3-yl)-pyrazolo[1,5- A ]pyrimidine-2-carboxylic acid

CAS: 1004727-44-9

Versatile small molecule scaffold

Formula: C₁₅H₁₃N₇O₂

Purity: Min. 95%

Molecular weight: 323.31 g/mol

Ref: 3D-EQB72744