
CAS 10048-32-5
:Parasorbic acid
Description:
Parasorbic acid, with the CAS number 10048-32-5, is an organic compound that belongs to the class of unsaturated dicarboxylic acids. It is structurally related to sorbic acid, featuring a conjugated double bond system that contributes to its reactivity and potential applications. This compound is typically a colorless to pale yellow solid and is known for its ability to act as a preservative due to its antimicrobial properties, making it useful in food and cosmetic formulations. Parasorbic acid can undergo various chemical reactions, including polymerization and esterification, which allows it to be utilized in the synthesis of other chemical compounds. Its solubility in organic solvents and limited solubility in water are important characteristics that influence its application in different industries. Additionally, like many organic acids, it exhibits acidic properties, which can affect the pH of formulations in which it is used. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C6H8O2
InChI:InChI=1S/C6H8O2/c1-5-3-2-4-6(7)8-5/h2,4-5H,3H2,1H3/t5-/m0/s1
InChI key:InChIKey=DYNKRGCMLGUEMN-YFKPBYRVSA-N
SMILES:C[C@@H]1OC(=O)C=CC1
Synonyms:- Parasorbic acid
- 2H-Pyran-2-one, 5,6-dihydro-6-methyl-, (S)-(+)-
- 2H-Pyran-2-one, 5,6-dihydro-6-methyl-, (6S)-
- 2H-Pyran-2-one, 5,6-dihydro-6-methyl-, (S)-
- (6S)-5,6-Dihydro-6-methyl-2H-pyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.