CAS 100482-44-8
:4-Chloro-1,1,1-trifluoro-4-(3-nitrophenyl)-2-(trifluoromethyl)-2-butan ol
Description:
4-Chloro-1,1,1-trifluoro-4-(3-nitrophenyl)-2-(trifluoromethyl)-2-butanol, with CAS number 100482-44-8, is a complex organic compound characterized by its unique functional groups and fluorinated structure. This substance features a butanol backbone, which is substituted with multiple fluorine atoms, enhancing its hydrophobic properties and potentially influencing its reactivity and stability. The presence of a nitrophenyl group introduces additional polarity and may affect the compound's electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The chlorinated and trifluoromethyl groups contribute to its overall lipophilicity and may enhance its biological activity. As with many fluorinated compounds, it may exhibit unique solubility characteristics and environmental persistence. Safety and handling considerations are crucial due to the potential toxicity associated with halogenated organic compounds. Overall, this compound's distinctive structure suggests potential utility in specialized chemical synthesis and research applications.
Formula:C11H8ClF6NO3
InChI:InChI=1/C11H8ClF6NO3/c12-8(6-2-1-3-7(4-6)19(21)22)5-9(20,10(13,14)15)11(16,17)18/h1-4,8,20H,5H2
SMILES:c1cc(cc(c1)N(=O)=O)C(CC(C(F)(F)F)(C(F)(F)F)O)Cl
Synonyms:- 2-Butanol, 4-chloro-4-(m-nitrophenyl)-1,1,1-trifluoro-2-(trifluoromethyl)-
- 4-Chloro-1,1,1-trifluoro-4-(3-nitrophenyl)-2-(trifluoromethyl)-2-butanol
- 4-Chloro-1,1,1-Trifluoro-4-(3-Nitrophenyl)-2-(Trifluoromethyl)Butan-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenepropanol, γ-chloro-3-nitro-α,α-bis(trifluoromethyl)-
CAS:Formula:C11H8ClF6NO3Molecular weight:351.6295
