CymitQuimica logo

CAS 100482-54-0

:

1-(m-Nitrophenyl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-ol

Description:
1-(m-Nitrophenyl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-ol, with CAS number 100482-54-0, is a chemical compound characterized by its unique structure that includes a trifluoromethyl group and a nitrophenyl moiety. This compound typically exhibits properties associated with both fluorinated organic compounds and nitroaromatic compounds, such as increased stability and potential reactivity due to the presence of electronegative fluorine atoms. The trifluoromethyl groups contribute to its lipophilicity and can influence its biological activity, while the nitrophenyl group may impart specific electronic properties that affect its reactivity and interaction with other molecules. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as a building block in organic chemistry. Additionally, its physical properties, such as solubility and boiling point, would be influenced by the presence of these functional groups, making it a subject of study for its chemical behavior and potential applications.
Formula:C11H7F6NO3
InChI:InChI=1/C11H7F6NO3/c12-10(13,14)9(11(15,16)17)5-8(19)6-2-1-3-7(4-6)18(20)21/h1-5,8,19H
SMILES:c1cc(cc(c1)N(=O)=O)C(C=C(C(F)(F)F)C(F)(F)F)O
Synonyms:
  • 2-Buten-1-ol, 1-(m-nitrophenyl)-4,4,4-trifluoro-3-trifluoromethyl-
  • 4,4,4-Trifluoro-1-(3-Nitrophenyl)-3-(Trifluoromethyl)But-2-En-1-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.