CymitQuimica logo

CAS 100482-55-1

:

1-(2-Thienyl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-ol

Description:
1-(2-Thienyl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-ol, with the CAS number 100482-55-1, is an organic compound characterized by its unique structural features, including a thienyl group and multiple trifluoromethyl substituents. The presence of the thienyl moiety imparts aromatic properties, while the trifluoromethyl groups enhance the compound's lipophilicity and influence its reactivity. This compound is likely to exhibit significant polarity due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, the presence of the alcohol functional group suggests potential for hydrogen bonding, which may influence its boiling point and melting point. The compound's structure indicates potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their biological activity and stability. Overall, 1-(2-Thienyl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-ol represents a complex molecule with interesting chemical properties that warrant further investigation for practical applications.
Formula:C9H6F6OS
InChI:InChI=1/C9H6F6OS/c10-8(11,12)7(9(13,14)15)4-5(16)6-2-1-3-17-6/h1-5,16H
SMILES:c1cc(C(C=C(C(F)(F)F)C(F)(F)F)O)sc1
Synonyms:
  • 2-Buten-1-ol, 1-thenyl-4,4,4-trifluoro-3-trifluoromethyl-
  • 2-Thiophenemethanol, alpha-(3,3,3-trifluoro-2-trifluoromethylpropenyl)-
  • alpha-(3,3,3-Trifluoro-2-trifluoromethylpropenyl)-2-thiophenemethanol
  • 4,4,4-Trifluoro-1-(Thiophen-2-Yl)-3-(Trifluoromethyl)But-2-En-1-Ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.