CymitQuimica logo

CAS 100482-56-2

:

1-(9-Anthryl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-one

Description:
1-(9-Anthryl)-4,4,4-trifluoro-3-trifluoromethyl-2-buten-1-one, identified by CAS number 100482-56-2, is an organic compound characterized by its complex structure, which includes an anthracene moiety and multiple trifluoromethyl groups. This compound features a conjugated system that enhances its electronic properties, making it potentially useful in various applications, including organic electronics and photonics. The presence of trifluoromethyl groups contributes to its lipophilicity and may influence its reactivity and stability. Additionally, the compound's unique structure may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, which can be exploited in materials science. Its synthesis typically involves multi-step organic reactions, and it may be of interest in research related to fluorinated compounds due to the unique characteristics imparted by the fluorine atoms. Overall, this compound represents a fascinating intersection of organic chemistry and materials science, with potential applications in advanced technologies.
Formula:C19H10F6O
InChI:InChI=1/C19H10F6O/c20-18(21,22)16(19(23,24)25)10-15(26)17-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)17/h1-10H
SMILES:c1ccc2c(c1)cc1ccccc1c2C(=O)C=C(C(F)(F)F)C(F)(F)F
Synonyms:
  • 2-Buten-1-one, 1-(9-anthryl)-4,4,4-trifluoro-3-trifluoromethyl-
  • 1-(Anthracen-9-Yl)-4,4,4-Trifluoro-3-(Trifluoromethyl)But-2-En-1-One
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.