CAS 100482-83-5
:3-(chloro-difluoro-methyl)-4,4,4-trifluoro-3-hydroxy-butanal
Description:
3-(Chloro-difluoro-methyl)-4,4,4-trifluoro-3-hydroxy-butanal, with CAS number 100482-83-5, is a fluorinated organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a butanal backbone, which is an aldehyde, and is further substituted with a hydroxyl group and several fluorine and chlorine atoms. The presence of these halogens significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The trifluoromethyl and difluoromethyl groups contribute to its unique electronic characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxyl group adds to its polarity, potentially affecting its solubility in different solvents. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the halogen substituents. Overall, this compound exemplifies the diverse behavior of halogenated organic molecules in chemical reactions and their potential utility in synthetic chemistry.
Formula:C5H4ClF5O2
InChI:InChI=1/C5H4ClF5O2/c6-4(7,8)3(13,1-2-12)5(9,10)11/h2,13H,1H2
SMILES:C(C=O)C(C(Cl)(F)F)(C(F)(F)F)O
Synonyms:- Butyraldehyde, 4-chloro-4,4-difluoro-3-hydroxy-3-(trifluoromethyl)-
- 4-Chloro-4,4-difluoro-3-hydroxy-3-(trifluoromethyl)butyraldehyde
- 4-Chloro-4,4-Difluoro-3-Hydroxy-3-(Trifluoromethyl)Butanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanal, 4-chloro-4,4-difluoro-3-hydroxy-3-(trifluoromethyl)-
CAS:Formula:C5H4ClF5O2Molecular weight:226.5291
