CAS 100482-85-7
:4,4-dichloro-3-(chloro-difluoro-methyl)-4-fluoro-3-hydroxy-butanal
Description:
4,4-Dichloro-3-(chloro-difluoro-methyl)-4-fluoro-3-hydroxy-butanal, with the CAS number 100482-85-7, is a synthetic organic compound characterized by its complex structure, which includes multiple halogen substituents and a hydroxyl group. This compound features a butanal backbone, indicating it is an aldehyde, with two chlorine atoms and one fluorine atom attached to the carbon chain, contributing to its reactivity and potential applications in various chemical processes. The presence of the hydroxyl group suggests it may exhibit properties typical of alcohols, such as hydrogen bonding, which can influence its solubility and boiling point. The difluoromethyl group adds to its unique chemical behavior, potentially enhancing its biological activity or reactivity in synthetic pathways. Due to its halogenated nature, this compound may also exhibit significant environmental persistence and toxicity, necessitating careful handling and consideration in applications. Overall, its intricate structure and functional groups make it a compound of interest in fields such as agrochemicals, pharmaceuticals, and materials science.
Formula:C5H4Cl3F3O2
InChI:InChI=1/C5H4Cl3F3O2/c6-4(7,9)3(13,1-2-12)5(8,10)11/h2,13H,1H2
SMILES:C(C=O)C(C(Cl)(Cl)F)(C(Cl)(F)F)O
Synonyms:- Butyraldehyde, 4,4-dichloro-4-fluoro-3-(chlorodifluoromethyl)-3-hydroxy-
- 4,4-Dichloro-4-fluoro-3-hydroxy-3-(chlorodifluoromethyl)-butyraldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanal, 4-chloro-3-(dichlorofluoromethyl)-4,4-difluoro-3-hydroxy-
CAS:Formula:C5H4Cl3F3O2Molecular weight:259.4383
