CAS 100485-65-2
:(αR)-3-Methyl-α-(1-methylethyl)benzenemethanamine
Description:
(αR)-3-Methyl-α-(1-methylethyl)benzenemethanamine, also known as a specific isomer of a substituted phenethylamine, is characterized by its structural features that include a benzene ring with a methyl group and an isopropyl group attached to the alpha position of the amine. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound may have applications in pharmaceuticals or as a chemical intermediate, given the presence of both aromatic and aliphatic components in its structure. Its stereochemistry, indicated by the (αR) designation, suggests that it has specific spatial arrangements that can influence its biological activity and interactions. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.
Formula:C11H17N
InChI:InChI=1S/C11H17N/c1-8(2)11(12)10-6-4-5-9(3)7-10/h4-8,11H,12H2,1-3H3/t11-/m1/s1
InChI key:InChIKey=IMVAKVFGEUFQCZ-LLVKDONJSA-N
SMILES:[C@H](C(C)C)(N)C1=CC(C)=CC=C1
Synonyms:- (αR)-3-Methyl-α-(1-methylethyl)benzenemethanamine
- Benzenemethanamine, 3-methyl-α-(1-methylethyl)-, (αR)-
- Benzenemethanamine, 3-methyl-α-(1-methylethyl)-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
