CAS 100487-74-9
:6-Chloro-5-fluoro-1,3-dihydro-2H-indol-2-one
Description:
6-Chloro-5-fluoro-1,3-dihydro-2H-indol-2-one is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound containing a benzene ring fused to a pyrrole ring. This compound features a chloro group at the 6-position and a fluoro group at the 5-position, contributing to its unique chemical properties and potential biological activity. The presence of these halogen substituents can influence the compound's reactivity, solubility, and interaction with biological targets. Typically, indole derivatives are of interest in medicinal chemistry due to their diverse pharmacological activities, including anti-inflammatory, antimicrobial, and anticancer properties. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Additionally, the compound's stability, melting point, and solubility in different solvents would be important characteristics to consider for its practical applications in research and industry.
Formula:C8H5ClFNO
InChI:InChI=1S/C8H5ClFNO/c9-5-3-7-4(1-6(5)10)2-8(12)11-7/h1,3H,2H2,(H,11,12)
InChI key:InChIKey=QDUXBJGXHPPFJG-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=CC1Cl)NC(=O)C2
Synonyms:- (4,5-Dichloro-2-Nitrophenyl)Acetic Acid
- 2H-Indol-2-one, 6-chloro-5-fluoro-1,3-dihydro-
- 5-Fluoro-6-chloro-2-oxindole
- 6-Chloro-5-Fluoroindolin-2-One
- 6-Chloro-5-fluoro-1,3-dihydro-2H-indol-2-one
- 6-Chloro-5-fluoro-1,3-dihydroindol-2-one
- 6-Chloro-5-fluoro-2-oxindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2H-Indol-2-one, 6-chloro-5-fluoro-1,3-dihydro-
CAS:Formula:C8H5ClFNOPurity:98%Color and Shape:SolidMolecular weight:185.58286-Chloro-5-fluoro-2-oxindole
CAS:<p>6-Chloro-5-fluoro-2-oxindole</p>Purity:97%Molecular weight:185.58g/mol6-Chloro-5-fluoro-2-oxindole
CAS:<p>6-Chloro-5-fluoro-2-oxindole is an antiinflammatory agent that has been shown to have analgesic properties in animal models. It is a precursor of antiinflammatory agents, such as indomethacin, and is used in the synthesis of other drugs. 6-Chloro-5-fluoro-2-oxindole has been shown to inhibit prostaglandin synthesis by acting on the cyclooxygenase enzyme and inhibiting the conversion of arachidonic acid to prostaglandins. This compound also inhibits the production of leukotrienes by interfering with the production of lipoxygenase.</p>Formula:C8H5ClFNOPurity:Min. 95%Molecular weight:185.58 g/mol6-Chloro-5-fluoroindolin-2-one
CAS:Formula:C8H5ClFNOPurity:98%Color and Shape:Liquid, No data available.Molecular weight:185.58



