CAS 100488-87-7: 2-(2-Acetyl-6-methoxy-3,9-dioxo-4,8-dioxa-2,10-diazaoctacos-1-yl)-1-ethylpyridinium chloride (1:1)
Description:2-(2-Acetyl-6-methoxy-3,9-dioxo-4,8-dioxa-2,10-diazaoctacos-1-yl)-1-ethylpyridinium chloride (1:1), with CAS number 100488-87-7, is a complex organic compound characterized by its unique structural features, including a pyridinium moiety and multiple functional groups such as acetyl and methoxy. This compound is likely to exhibit solubility in polar solvents due to the presence of the pyridinium cation and the chloride anion, which can enhance its ionic character. The presence of dioxo and dioxa groups suggests potential reactivity and the ability to participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Its molecular structure indicates potential applications in fields such as medicinal chemistry, where derivatives may exhibit biological activity, or in materials science for the development of novel compounds. Additionally, the presence of multiple heteroatoms in the structure may influence its electronic properties, making it a candidate for further investigation in various chemical contexts.
Formula:C34H60N3O6·Cl
InChI:InChI=1S/C34H59N3O6.ClH/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-25-35-33(39)42-28-32(41-4)29-43-34(40)37(30(3)38)27-31-24-21-23-26-36(31)6-2;/h21,23-24,26,32H,5-20,22,25,27-29H2,1-4H3;1H
InChI key:InChIKey=APUCCVGQZPNXIO-UHFFFAOYSA-N
SMILES:[Cl-].O=C(OCC(OC)COC(=O)N(C(=O)C)CC=1C=CC=C[N+]1CC)NCCCCCCCCCCCCCCCCCC
- Synonyms:
- 2-(2-Acetyl-6-methoxy-3,9-dioxo-4,8-dioxa-2,10-diazaoctacos-1-yl)-1-ethylpyridinium chloride (1:1)
- Cv 6209
- Pyridinium, 2-(2-Acetyl-6-Methoxy-3,9-Dioxo-4,8-Dioxa-2,10-Diazaoctacos-1-Yl)-1-Ethyl-, Chloride (1:1)
- Pyridinium, 2-(2-acetyl-6-methoxy-3,9-dioxo-4,8-dioxa-2,10-diazaoctacos-1-yl)-1-ethyl-, chloride

Pyridinium, 2-(2-acetyl-6-methoxy-3,9-dioxo-4,8-dioxa-2,10-diazaoctacos-1-yl)-1-ethyl-, chloride (1:1)
Ref: IN-DA000243
1mg | 628.00 € | ||
5mg | To inquire |

CV-6209
Controlled ProductRef: TR-C856000
1mg | 278.00 € | ||
5mg | 1,174.00 € | ||
10mg | 2,097.00 € |

CV 6209
Ref: 3D-FC20594
1mg | 514.00 € | ||
2mg | 912.00 € | ||
5mg | 1,935.00 € | ||
10mg | 2,931.00 € |

CV-6209
Ref: TM-T27102
1mg | 127.00 € | ||
5mg | 540.00 € | ||
10mg | 847.00 € |