CAS 10049-36-2
:Triethanolammonium borate
Description:
Triethanolammonium borate, with the CAS number 10049-36-2, is a chemical compound that combines triethanolamine, a tri-functional amine, with borate ions. This substance typically appears as a white to off-white solid and is soluble in water, making it useful in various applications. It exhibits characteristics such as being hygroscopic, meaning it can absorb moisture from the air. Triethanolammonium borate is often utilized in the formulation of adhesives, coatings, and as a buffering agent in chemical processes due to its ability to stabilize pH levels. Additionally, it may serve as a flame retardant and is sometimes employed in agricultural formulations. The compound is generally considered to have low toxicity, but safety precautions should be observed during handling to avoid irritation. Its unique properties stem from the combination of the triethanolamine's amine functionalities and the borate's ability to form complexes, which can enhance the performance of various products in which it is incorporated.
Formula:C6H15NO3·xBH3O3
InChI:InChI=1S/C6H15NO3.BH3O3/c8-4-1-7(2-5-9)3-6-10;2-1(3)4/h8-10H,1-6H2;2-4H
InChI key:InChIKey=HJVAFZMYQQSPHF-UHFFFAOYSA-N
SMILES:B(O)(O)O.N(CCO)(CCO)CCO
Synonyms:- Ethanol, 2,2′,2′′-nitrilotri-, compd. with boric acid (H3BO3)
- Boric acid (H3BO3), compd. with 2,2′,2′′-nitrilotris[ethanol]
- Boric acid (H3BO3), compd. with 2,2′,2′′-nitrilotris[ethanol] (1:?)
- Boric acid (H3BO3), compd. with 2,2′,2′′-nitrilotriethanol
- Ethanol, 2,2′,2′′-nitrilotris-, compd. with boric acid (H3BO3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
