CAS 100495-98-5: (3R,4R,5R,6S)-3,4,5-trihydroxy-6-[2-(2-methyl-5-nitro-imidazol-1-yl)ethoxy]tetrahydropyran-2-carboxylic acid
Description:The chemical substance known as (3R,4R,5R,6S)-3,4,5-trihydroxy-6-[2-(2-methyl-5-nitro-imidazol-1-yl)ethoxy]tetrahydropyran-2-carboxylic acid, with the CAS number 100495-98-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups that contribute to its hydrophilicity and potential for forming hydrogen bonds. The presence of a carboxylic acid functional group indicates acidic properties, while the imidazole moiety suggests potential biological activity, possibly as an antimicrobial agent. The specific stereochemistry, denoted by the (3R,4R,5R,6S) configuration, implies that the compound may exhibit chiral properties, influencing its interaction with biological systems and receptors. This compound is likely to be soluble in polar solvents due to its hydroxyl and carboxylic acid groups, and its structural complexity may allow for various applications in pharmaceuticals or biochemistry, particularly in drug design or as a biochemical probe. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.
Formula:C12H17N3O9
InChI:InChI=1S/C12H17N3O9/c1-5-13-4-6(15(21)22)14(5)2-3-23-12-9(18)7(16)8(17)10(24-12)11(19)20/h4,7-10,12,16-18H,2-3H2,1H3,(H,19,20)/t7-,8-,9+,10-,12+/m0/s1
InChI key:InChIKey=KOVNZSSTXZPVCG-GOVZDWNOSA-N
SMILES:O=C(O)C1OC(OCCN2C(=NC=C2N(=O)=O)C)C(O)C(O)C1O

β-D-Glucopyranosiduronic acid, 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl
Ref: IN-DA00024Z
Undefined size | To inquire |

Metronidazole-O-Glucuronide
Ref: 4Z-M-6310
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Ref: 7W-GC6083
1mg | 481.00 € | ||
2mg | 733.00 € | ||
5mg | 1,349.00 € | ||
10mg | 2,390.00 € |

Metronidazole Beta-D-Glucuronide
Controlled ProductRef: TR-M338890
1mg | 340.00 € | ||
5mg | 1,201.00 € |

Metronidazole b-D-glucuronide
Ref: 3D-MM31785
1mg | 501.00 € | ||
2mg | 685.00 € | ||
5mg | 1,179.00 € | ||
10mg | 1,785.00 € |