CymitQuimica logo

CAS 100499-64-7

:

N-(5-Methyl-4-isoxazolyl)propanamide

Description:
N-(5-Methyl-4-isoxazolyl)propanamide is a chemical compound characterized by its isoxazole ring, which contributes to its unique properties. The isoxazole moiety is a five-membered heterocyclic structure containing both nitrogen and oxygen, enhancing the compound's potential for biological activity. This compound features a propanamide functional group, indicating the presence of an amide bond, which typically imparts stability and influences solubility in polar solvents. The methyl group at the 5-position of the isoxazole ring can affect the compound's steric and electronic properties, potentially impacting its reactivity and interaction with biological targets. N-(5-Methyl-4-isoxazolyl)propanamide may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or anti-inflammatory research. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular interactions and the presence of functional groups.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-3-7(10)9-6-4-8-11-5(6)2/h4H,3H2,1-2H3,(H,9,10)
InChI key:InChIKey=ZNLWTSGIUNYWLW-UHFFFAOYSA-N
SMILES:N(C(CC)=O)C1=C(C)ON=C1
Synonyms:
  • Propanamide, N-(5-methyl-4-isoxazolyl)-
  • 5-Methyl-4-(N-propionylamino)isoxazole
  • N-(5-Methyl-4-isoxazolyl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.