CAS 1004991-91-6

4-Chloro-5H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile

Description:

4-Chloro-5H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 4-position and a cyano group at the 3-position, contributing to its chemical reactivity and potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar organic solvents. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, making it a valuable intermediate in organic synthesis. Additionally, compounds of this class have been studied for their potential pharmacological properties, including anti-inflammatory and anti-cancer activities. The molecular structure allows for various substitutions, which can lead to a diverse range of derivatives with tailored properties. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.

Formula: C₆H₂ClN₅

InChI: InChI=1S/C6H2ClN5/c7-5-4-3(1-8)11-12-6(4)10-2-9-5/h2H,(H,9,10,11,12)

SMILES: C(#N)c1c2c(Cl)ncnc2[nH]n1

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine-3-carbonitrile, 4-chloro-

4-Chloro-1H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile

CAS: 1004991-91-6

Formula: C₆H₂ClN₅

Molecular weight: 179.5666

Ref: IN-DA00024O

4-Chloro-1H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile

CAS: 1004991-91-6

4-Chloro-1H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile

Purity: ≥95%

Molecular weight: 179.57g/mol

Ref: 54-OR305555