CAS 1004997-73-2

Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2)

Description:

Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and bromine substitution on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the amino group contributes to its basicity, while the bromine atom can influence its reactivity and potential applications in organic synthesis. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated amines can pose health risks. Overall, its unique structural features make it a compound of interest in chemical research and development.

Formula: C₇H₉BrN₂·2ClH

InChI: InChI=1S/C7H9BrN2.2ClH/c8-6-1-2-7(10)5(3-6)4-9;;/h1-3H,4,9-10H2;2*1H

InChI key: InChIKey=MVVCFHINSNWABH-UHFFFAOYSA-N

SMILES: C(N)C1=C(N)C=CC(Br)=C1.Cl

Synonyms:

• Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2)
• (5-Bromo-2-aminobenzyl)amine dihydrochloride
• 2-(Aminomethyl)-4-bromoaniline dihydrochloride

2-(Aminomethyl)-4-bromoaniline dihydrochloride

CAS: 1004997-73-2

Formula: C₇H₁₁BrCl₂N₂

Color and Shape: Solid

Molecular weight: 273.9856

Ref: IN-DA00024M