
CAS 1004997-73-2
:Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2)
Description:
Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and bromine substitution on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the amino group contributes to its basicity, while the bromine atom can influence its reactivity and potential applications in organic synthesis. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated amines can pose health risks. Overall, its unique structural features make it a compound of interest in chemical research and development.
Formula:C7H9BrN2·2ClH
InChI:InChI=1S/C7H9BrN2.2ClH/c8-6-1-2-7(10)5(3-6)4-9;;/h1-3H,4,9-10H2;2*1H
InChI key:InChIKey=MVVCFHINSNWABH-UHFFFAOYSA-N
SMILES:C(N)C1=C(N)C=CC(Br)=C1.Cl
Synonyms:- Benzenemethanamine, 2-amino-5-bromo-, hydrochloride (1:2)
- (5-Bromo-2-aminobenzyl)amine dihydrochloride
- 2-(Aminomethyl)-4-bromoaniline dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Aminomethyl)-4-bromoaniline dihydrochloride
CAS:Formula:C7H11BrCl2N2Color and Shape:SolidMolecular weight:273.9856
