
CAS 1005-05-6
:2-Mercapto-1-(1-piperidinyl)ethanone
Description:
2-Mercapto-1-(1-piperidinyl)ethanone, also known by its CAS number 1005-05-6, is a chemical compound characterized by the presence of a thiol group (-SH) and a piperidine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a distinct odor, often described as sulfurous due to the thiol functional group. The presence of the piperidine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. 2-Mercapto-1-(1-piperidinyl)ethanone is soluble in organic solvents and may exhibit moderate solubility in water. It is important to handle this compound with care, as thiols can be reactive and may participate in various chemical reactions, including oxidation and nucleophilic substitution. Additionally, safety precautions should be taken due to potential toxicity and irritant properties associated with thiol compounds. Overall, this substance is significant in both synthetic organic chemistry and potential pharmaceutical applications.
Formula:C7H13NOS
InChI:InChI=1S/C7H13NOS/c9-7(6-10)8-4-2-1-3-5-8/h10H,1-6H2
InChI key:InChIKey=GVEPWYLNBKUPDJ-UHFFFAOYSA-N
SMILES:C(CS)(=O)N1CCCCC1
Synonyms:- Piperidine, 1-(mercaptoacetyl)-
- Ethanone, 2-mercapto-1-(1-piperidinyl)-
- 1-(Piperidin-1-yl)-2-sulfanylethan-1-one
- 2-Mercapto-1-(1-piperidinyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
