
CAS 1005-29-4
:1-Methyl-4-(1-methylethyl)piperidine
Description:
1-Methyl-4-(1-methylethyl)piperidine, with the CAS number 1005-29-4, is a chemical compound belonging to the class of piperidines, which are six-membered heterocyclic compounds containing a nitrogen atom. This particular compound features a methyl group and an isopropyl group attached to the piperidine ring, contributing to its unique structural characteristics. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure imparts certain physical properties, such as moderate solubility in organic solvents and relatively low solubility in water. Additionally, 1-Methyl-4-(1-methylethyl)piperidine may exhibit basicity due to the presence of the nitrogen atom, allowing it to participate in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H19N
InChI:InChI=1S/C9H19N/c1-8(2)9-4-6-10(3)7-5-9/h8-9H,4-7H2,1-3H3
InChI key:InChIKey=FWXQAPCXSSZHFU-UHFFFAOYSA-N
SMILES:C(C)(C)C1CCN(C)CC1
Synonyms:- 1-Methyl-4-(1-methylethyl)piperidine
- Piperidine, 1-methyl-4-(1-methylethyl)-
- Piperidine, 4-isopropyl-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.