CymitQuimica logo

CAS 1005-31-8

:

4-Dimethylaminopyridine N-Oxide

Description:
4-Dimethylaminopyridine N-Oxide (CAS 1005-31-8) is a chemical compound that serves as a versatile catalyst and reagent in organic synthesis. It is a derivative of 4-dimethylaminopyridine (DMAP), featuring an N-oxide functional group that enhances its nucleophilicity and reactivity. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar organic solvents such as methanol and acetonitrile. Its molecular formula is C7H10N2O, and it has a molecular weight that reflects its structural components. 4-Dimethylaminopyridine N-Oxide is known for its ability to facilitate acylation reactions and is often employed in the synthesis of esters and amides. Additionally, it can act as a base in various chemical transformations. Due to its properties, it is widely used in the pharmaceutical and fine chemical industries. However, like many chemical substances, it should be handled with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-8(2)7-3-5-9(10)6-4-7/h3-6H,1-2H3
InChI key:WZMNQOYCHMGCSS-UHFFFAOYSA-N
SMILES:CN(C)c1ccn(=O)cc1
Synonyms:
  • N,N-Dimethyl-4-pyridinamine, 1-oxide
  • N,N-dimethylpyridin-4-amine 1-oxide
Found 5 products.