CAS 1005-33-0
:(4-chlorophenyl)phosphonous dichloride
Description:
(4-Chlorophenyl)phosphonous dichloride, with the CAS number 1005-33-0, is an organophosphorus compound characterized by its phosphorus atom bonded to a phenyl group substituted with a chlorine atom and two chlorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the phosphorus-chlorine bonds. It is often used as a reagent in organic synthesis, particularly in the preparation of phosphonates and phosphonamides. The presence of the chlorophenyl group imparts certain aromatic characteristics, influencing its chemical behavior and potential applications. Additionally, like many organophosphorus compounds, it may exhibit toxicity and should be handled with care, following appropriate safety protocols. Its properties, such as boiling point and solubility, can vary based on environmental conditions and the presence of other substances. Overall, (4-chlorophenyl)phosphonous dichloride is a valuable compound in synthetic chemistry, particularly in the development of phosphorus-containing organic molecules.
Formula:C6H4Cl3P
InChI:InChI=1/C6H4Cl3P/c7-5-1-3-6(4-2-5)10(8)9/h1-4H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.