CymitQuimica logo

CAS 1005-37-4

:

6-chloro-N~4~-methylpyrimidine-2,4-diamine

Description:
6-Chloro-N4-methylpyrimidine-2,4-diamine, with the CAS number 1005-37-4, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features a chlorine substituent at the 6-position and two amino groups at the 2 and 4 positions, along with a methyl group at the N4 position. These functional groups contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the amino groups makes it a potential candidate for further chemical modifications, while the chlorine atom can influence its biological activity and solubility. The compound is typically solid at room temperature and may exhibit specific solubility characteristics in polar and non-polar solvents. Its synthesis and characterization are of interest in medicinal chemistry, particularly for developing compounds with potential therapeutic effects. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H7ClN4
InChI:InChI=1/C5H7ClN4/c1-8-4-2-3(6)9-5(7)10-4/h2H,1H3,(H3,7,8,9,10)
InChI key:CXWJDRREGHIEMH-UHFFFAOYSA-N
SMILES:CN=c1cc(Cl)[nH]c(=N)[nH]1
Synonyms:
  • 2,4-pyrimidinediamine, 6-chloro-N~4~-methyl-
Found 4 products.