
CAS 1005-51-2
:Tricyclo[3.3.2.02,8]deca-3,6,9-triene
Description:
Tricyclo[3.3.2.0²,⁸]deca-3,6,9-triene, with the CAS number 1005-51-2, is a polycyclic hydrocarbon characterized by its unique tricyclic structure, which consists of three interconnected cyclopropane and cyclobutane rings. This compound features a conjugated system of double bonds, contributing to its stability and reactivity. The presence of multiple double bonds allows for potential electrophilic reactions and makes it a subject of interest in organic synthesis and materials science. Tricyclo[3.3.2.0²,⁸]deca-3,6,9-triene is typically a colorless to pale yellow liquid at room temperature and exhibits a relatively low boiling point compared to larger hydrocarbons. Its molecular structure imparts interesting optical and electronic properties, making it a candidate for applications in organic electronics and photonics. Additionally, due to its unique arrangement of carbon atoms, it may exhibit strain, influencing its chemical behavior and reactivity. Overall, this compound serves as a valuable model for studying the properties and reactions of polycyclic aromatic hydrocarbons.
Formula:C10H10
InChI:InChI=1S/C10H10/c1-4-8-9-5-2-7(1)3-6-10(8)9/h1-10H
InChI key:InChIKey=UKFBVTJTKMSPMI-UHFFFAOYSA-N
SMILES:C12C3C1C=CC(C=C2)C=C3
Synonyms:- NSC 120527
- Bullvalene
- Tricyclo[3.3.2.02,8]deca-3,6,9-triene
- Bullvalene (C10H10)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
