CAS 1005-63-6
:4-VINYLOXY-PHENYLAMINE
Description:
4-Vinyloxy-phenylamine, with the CAS number 1005-63-6, is an organic compound characterized by the presence of both a vinyl ether and an amine functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the vinyl group, which can participate in various polymerization reactions, making it useful in the synthesis of polymers and copolymers. The amine group contributes to its potential as a nucleophile in chemical reactions, allowing for further functionalization. Additionally, 4-vinyloxy-phenylamine may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions, although it may be sensitive to moisture and air. Safety considerations are important, as it may pose risks such as skin irritation or respiratory issues upon exposure. Overall, this compound serves as a valuable intermediate in organic synthesis and materials science.
Formula:C8H9NO
InChI:InChI=1/C8H9NO/c1-2-10-8-5-3-7(9)4-6-8/h2-6H,1,9H2
SMILES:C=COc1ccc(cc1)N
Synonyms:- Timtec-Bb Sbb010266
- 4-(Ethenyloxy)Aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
