CAS 1005009-96-0
:2-[4-Methoxy-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[4-Methoxy-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted phenyl group. The presence of methoxy and trifluoromethoxy groups on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and solubility in various solvents. This compound is typically used in organic synthesis, particularly in the formation of carbon-boron bonds, which are crucial in cross-coupling reactions. The dioxaborolane structure is known for its stability and ability to participate in nucleophilic reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the trifluoromethoxy group can impart unique characteristics such as increased lipophilicity and altered biological activity. Overall, this compound exemplifies the versatility of boron chemistry in synthetic applications.
Formula:C14H18BF3O4
InChI:InChI=1S/C14H18BF3O4/c1-12(2)13(3,4)22-15(21-12)9-6-7-10(19-5)11(8-9)20-14(16,17)18/h6-8H,1-5H3
InChI key:InChIKey=MPSGQKZFOMZHDM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(OC(F)(F)F)=C(OC)C=C2
Synonyms:- 1,3,2-Dioxaborolane, 2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-
- 2-(3-(Trifluoromethoxy)-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2-[4-Methoxy-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-
CAS:Formula:C14H18BF3O4Molecular weight:318.0965
