CymitQuimica logo

CAS 1005036-25-8

:

6-(2-Pyridinyl)-3(2H)-pyridazinethione

Description:
6-(2-Pyridinyl)-3(2H)-pyridazinethione, identified by its CAS number 1005036-25-8, is a chemical compound that features a pyridazine core substituted with a pyridine group. This compound is characterized by its thione functional group, which is a sulfur-containing moiety that can influence its reactivity and properties. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry, as well as its ability to participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Additionally, the structural features of this compound suggest potential applications in materials science and organic synthesis. As with many heterocyclic compounds, its properties can be influenced by the electronic effects of the nitrogen atoms in the rings, which can affect its acidity, basicity, and overall chemical behavior.
Formula:C9H7N3S
InChI:InChI=1S/C9H7N3S/c13-9-5-4-8(11-12-9)7-3-1-2-6-10-7/h1-6H,(H,12,13)
InChI key:InChIKey=HBGYAZVOIPRLHX-UHFFFAOYSA-N
SMILES:S=C1C=CC(=NN1)C2=CC=CC=N2
Synonyms:
  • 6-(2-Pyridinyl)-3(2H)-pyridazinethione
  • 3(2H)-Pyridazinethione, 6-(2-pyridinyl)-
  • 6-(Pyridin-2-yl)-2H-pyridazin-3-thione
Found 2 products.