CAS 100508-44-9
:6,10,13-Trimethyltetradecyl 3-methylbutanoate
Description:
6,10,13-Trimethyltetradecyl 3-methylbutanoate is an ester compound characterized by its long hydrocarbon chain and branched alkyl groups. It features a tetradecyl backbone, which consists of 14 carbon atoms, with three methyl groups located at the 6th, 10th, and 13th positions, contributing to its branched structure. The presence of the 3-methylbutanoate moiety indicates that it is derived from 3-methylbutanoic acid, which adds to its complexity and potential for varied interactions. This compound is likely to exhibit hydrophobic properties due to its long carbon chain, making it less soluble in water but more soluble in organic solvents. Its unique structure may impart specific physical properties, such as a relatively high boiling point and viscosity compared to simpler esters. Additionally, it may have applications in fields such as surfactants, lubricants, or as an additive in various formulations, although specific applications would depend on further research into its behavior and compatibility with other substances.
Formula:C22H44O2
InChI:InChI=1S/C22H44O2/c1-18(2)14-15-21(6)13-10-12-20(5)11-8-7-9-16-24-22(23)17-19(3)4/h18-21H,7-17H2,1-6H3
InChI key:InChIKey=APHRWGIGLRUJLA-UHFFFAOYSA-N
SMILES:C(CC(C)C)(OCCCCCC(CCCC(CCC(C)C)C)C)=O
Synonyms:- 6,10,13-Trimethyltetradecyl 3-methylbutanoate
- Butanoic acid, 3-methyl-, 6,10,13-trimethyltetradecyl ester
- 6,10,13-Trimethyltetradecyl isovalerate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
