CymitQuimica logo

CAS 100508-56-3

:

2,4-Dimethoxy-6-(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine

Description:
2,4-Dimethoxy-6-(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine is a chemical compound that belongs to the class of triazines, which are heterocyclic compounds containing a six-membered ring with three nitrogen atoms. This specific triazine derivative features two methoxy groups and a dinitroethoxy substituent, contributing to its unique chemical properties. The presence of the fluorine atom and the dinitro group enhances its reactivity and potential applications in various fields, including agrochemicals and pharmaceuticals. The compound is characterized by its relatively high stability under standard conditions, but it may undergo hydrolysis or other reactions in the presence of strong acids or bases. Its molecular structure suggests potential for interactions with biological systems, making it of interest for research in medicinal chemistry. Safety data should be consulted for handling, as the presence of nitro groups can indicate explosive or toxic properties. Overall, 2,4-Dimethoxy-6-(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine is a complex molecule with diverse applications and significant chemical reactivity.
Formula:C7H8FN5O7
InChI:InChI=1/C7H8FN5O7/c1-18-4-9-5(19-2)11-6(10-4)20-3-7(8,12(14)15)13(16)17/h3H2,1-2H3
SMILES:COc1nc(nc(n1)OCC(F)(N(=O)=O)N(=O)=O)OC
Synonyms:
  • 2-(2-Fluoro-2,2-Dinitroethoxy)-4,6-Dimethoxy-1,3,5-Triazine
  • 2,4-Dimethoxy-6-(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.