CAS 100513-53-9
:1,7,9,11,13,15,17,19,21,24,25,26-dodecadeoxy-25-[(3E)-5-(2-hydroxy-1-methyl-4-oxo-4,5-dihydro-1H-pyrrol-3-yl)-2,4-dimethyl-5-oxopent-3-en-1-yl]-15,17,21-trimethyl-1-[3,4,5,6-tetrahydroxy-6-(2-hydroxydodecyl)tetrahydro-2H-pyran-2-yl]hexacositol
Description:
The chemical substance known as "1,7,9,11,13,15,17,19,21,24,25,26-dodecadeoxy-25-[(3E)-5-(2-hydroxy-1-methyl-4-oxo-4,5-dihydro-1H-pyrrol-3-yl)-2,4-dimethyl-5-oxopent-3-en-1-yl]-15,17,21-trimethyl-1-[3,4,5,6-tetrahydroxy-6-(2-hydroxydodecyl)tetrahydro-2H-pyran-2-yl]hexacositol" (CAS 100513-53-9) is a complex organic molecule characterized by its extensive polyol structure, which includes multiple hydroxyl groups contributing to its hydrophilicity. This compound features a long carbon chain, indicative of its potential role in biological systems, possibly as a surfactant or emulsifier. The presence of various functional groups, such as ketones and pyrrole derivatives, suggests potential reactivity and biological activity. Its intricate structure may also imply specific interactions with biological membranes or proteins, making it of interest in pharmaceutical or biochemical research. The molecular weight and specific stereochemistry would further influence its physical properties, such as solubility and melting point, which are critical for applications in drug formulation or as a biochemical probe.
Formula:C58H107NO23
InChI:InChI=1/C58H107NO23/c1-9-10-11-12-13-14-15-16-17-35(60)27-58(81)56(79)55(78)53(76)46(82-58)26-44(69)52(75)54(77)51(74)43(68)24-38(63)22-36(61)21-37(62)23-39(64)32(5)49(72)33(6)40(65)25-41(66)34(7)50(73)42(67)20-30(3)18-29(2)19-31(4)48(71)47-45(70)28-59(8)57(47)80/h19,29-30,32-44,46,49-56,60-69,72-81H,9-18,20-28H2,1-8H3/b31-19+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Blasticidin A
CAS:Blasticidin A, from S. resistomycificus, inhibits A. parasiticus aflatoxin (IC50s: 0.25 μM) but not growth; also halts protein synthesis in S. cerevisiae.Formula:C58H107NO23Color and Shape:SolidMolecular weight:1186.478

