CymitQuimica logo

CAS 1005171-85-6

:

6-Methoxy-4-(trifluoromethyl)-3-pyridinecarboxaldehyde

Description:
6-Methoxy-4-(trifluoromethyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 6-position and a trifluoromethyl group (-CF3) at the 4-position significantly influences its chemical properties, including its reactivity and polarity. The aldehyde functional group (-CHO) at the 3-position contributes to its potential as a reactive intermediate in various organic synthesis reactions. This compound is typically used in the development of pharmaceuticals and agrochemicals due to its unique electronic properties and ability to participate in nucleophilic addition reactions. Additionally, the trifluoromethyl group enhances lipophilicity and metabolic stability, making it a valuable moiety in drug design. Its molecular structure allows for various applications in medicinal chemistry, particularly in the synthesis of biologically active compounds. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-14-7-2-6(8(9,10)11)5(4-13)3-12-7/h2-4H,1H3
InChI key:InChIKey=ZFCSTKUBEISMAN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(C=O)=CN=C(OC)C1
Synonyms:
  • 6-Methoxy-4-(trifluoromethyl)nicotinaldehyde
  • 3-Pyridinecarboxaldehyde, 6-methoxy-4-(trifluoromethyl)-
  • 2-Methoxy-4-trifluoromethylpyridine-5-carboxaldehyde
  • 6-Methoxy-4-(trifluoromethyl)-3-pyridinecarboxaldehyde
Found 4 products.