CAS 100519-34-4
:ethyl [4-(acetyloxy)phenyl](oxo)acetate
Description:
Ethyl [4-(acetyloxy)phenyl](oxo)acetate, with the CAS number 100519-34-4, is an organic compound characterized by its ester functional group and a phenyl ring substituted with an acetyloxy group. This compound typically exhibits a moderate to high polarity due to the presence of both ester and carbonyl functionalities, which can influence its solubility in various organic solvents. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the acetyloxy group suggests potential reactivity, particularly in nucleophilic substitution reactions. Ethyl [4-(acetyloxy)phenyl](oxo)acetate may also display biological activity, making it of interest in pharmaceutical and chemical research. Its synthesis typically involves esterification and acylation reactions, and it may serve as an intermediate in the production of more complex organic molecules. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.
Formula:C12H12O5
InChI:InChI=1/C12H12O5/c1-3-16-12(15)11(14)9-4-6-10(7-5-9)17-8(2)13/h4-7H,3H2,1-2H3
SMILES:CCOC(=O)C(=O)c1ccc(cc1)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
