CAS 1005196-13-3
:2-(4-Fluorophenyl)thiazole
Description:
2-(4-Fluorophenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, which is directly attached to the thiazole. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of polarity due to the functional groups present. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, owing to the structural features that can interact with biological targets. The compound's reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which can affect its chemical behavior in reactions. Additionally, 2-(4-Fluorophenyl)thiazole may serve as a building block in the synthesis of more complex molecules in medicinal chemistry and material science.
Formula:C9H6FNS
InChI:InChI=1S/C9H6FNS/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-6H
InChI key:InChIKey=WZAFKSDODCFYPN-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=C1)C2=NC=CS2
Synonyms:- 2-(4-Fluorophenyl)-1,3-thiazole
- Thiazole, 2-(4-fluorophenyl)-
- 2-(4-Fluorophenyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
