CAS 100524-07-0
:3-AMINO-BENZAMIDE OXIME
Description:
3-Amino-benzamide oxime is an organic compound characterized by the presence of both an amino group and an oxime functional group attached to a benzamide structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its complex structure. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. It may exhibit properties such as solubility in polar solvents and moderate stability under standard conditions. The presence of the amino group can contribute to its reactivity, allowing for further chemical modifications. Additionally, the oxime functionality may participate in various chemical reactions, including condensation and rearrangement processes. Overall, 3-amino-benzamide oxime is a versatile compound with significant implications in research and development within the field of organic chemistry and drug design.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c8-6-3-1-2-5(4-6)7(9)10-11/h1-4,11H,8H2,(H2,9,10)
SMILES:c1cc(cc(c1)N)C(=N)NO
Synonyms:- 3-Amino-N-Hydroxy-Benzamidine
- 3-Aminobenzamidoxime
- 3-amino-N'-hydroxybenzenecarboximidamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Aminobenzamide oxime
CAS:<p>3-Aminobenzamide oxime is a molecular entity that is used in research to modify the phenotype of cells. 3-Aminobenzamide oxime has been shown to have synergistic effects with other drugs, such as tnf-α, which may be due to its ability to alter the nature of certain cellular devices or its ability to act as a ligand for polyvalent metals. 3-Aminobenzamide oxime is also used in the production of nitrite by reacting with HNO2, which may be due to its chemical formula and functionalities.</p>Formula:C7H9N3OPurity:Min. 95%Molecular weight:151.17 g/mol
