CAS 100524-26-3
:Hydrazinecarboximidamide, N-nitro-2-phenyl-
Description:
Hydrazinecarboximidamide, N-nitro-2-phenyl- is a chemical compound characterized by its unique functional groups, including hydrazine, carboximidamide, and nitro groups, along with a phenyl substituent. This compound typically exhibits properties associated with both hydrazine derivatives and nitro compounds, such as potential reactivity and the ability to participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The presence of the nitro group often imparts increased polarity and can influence the compound's solubility in polar solvents. Additionally, the phenyl group contributes to the compound's stability and can affect its electronic properties. Due to its structural features, this compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. However, specific safety and handling guidelines should be followed, as compounds containing hydrazine and nitro groups can be hazardous. Always consult relevant safety data sheets and regulatory guidelines when working with such substances.
Formula:C7H9N5O2
InChI:InChI=1S/C7H9N5O2/c8-7(11-12(13)14)10-9-6-4-2-1-3-5-6/h1-5,9H,(H3,8,10,11)
InChI key:InChIKey=MCLGHWONVQHBKG-UHFFFAOYSA-N
SMILES:N(NC(NN(=O)=O)=N)C1=CC=CC=C1
Synonyms:- NSC 137993
- Guanidine, 1-anilino-3-nitro-
- Carbonimidic dihydrazide, 2,2-dihydroxy-2′-phenyl-
- Hydrazinecarboximidamide, N-nitro-2-phenyl-
- 2-Anilino-1-nitroguanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
