CAS 100532-14-7

α,2,5-Trimethyl-α-(1-methylethyl)benzenemethanol

Description:

α,2,5-Trimethyl-α-(1-methylethyl)benzenemethanol, with the CAS number 100532-14-7, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with multiple alkyl groups and a hydroxyl functional group. This compound features a branched isopropyl group and three methyl groups, contributing to its hydrophobic nature and potential for various interactions in chemical reactions. It is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its physical properties such as boiling point and viscosity. Additionally, this compound may have applications in fragrance formulations or as an intermediate in organic synthesis, given its structural features. Its stability and reactivity would depend on the specific conditions, including temperature and the presence of catalysts or other reactants. Overall, α,2,5-Trimethyl-α-(1-methylethyl)benzenemethanol is a versatile compound with potential utility in various chemical contexts.

Formula: C₁₃H₂₀O

InChI: InChI=1S/C13H20O/c1-9(2)13(5,14)12-8-10(3)6-7-11(12)4/h6-9,14H,1-5H3

InChI key: InChIKey=APRAPVBTCACGPU-UHFFFAOYSA-N

SMILES: C(C(C)C)(C)(O)C1=C(C)C=CC(C)=C1

Synonyms:

• α,2,5-Trimethyl-α-(1-methylethyl)benzenemethanol
• Benzenemethanol, α,2,5-trimethyl-α-(1-methylethyl)-
• Benzyl alcohol, α-isopropyl-α,2,5-trimethyl-
• 2-(2,5-Dimethylphenyl)-3-methyl-butan-2-ol
• 2-(2,5-Dimethylphenyl)-3-methylbutan-2-ol