CAS 1005346-97-3
:2-Bromo-5-methoxy-N-methylbenzeneacetamide
Description:
2-Bromo-5-methoxy-N-methylbenzeneacetamide, with the CAS number 1005346-97-3, is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring. The presence of the N-methyl group indicates that it is a derivative of acetamide, contributing to its potential biological activity. This compound is likely to exhibit moderate polarity due to the methoxy group, which can influence its solubility in various solvents. The bromine substituent may impart unique reactivity, making it a candidate for further chemical transformations. Additionally, the compound may possess pharmacological properties, as many benzeneacetamides are known for their biological activities. Its synthesis and handling would require standard laboratory safety protocols, considering the presence of bromine, which can be hazardous. Overall, 2-Bromo-5-methoxy-N-methylbenzeneacetamide is of interest in both synthetic organic chemistry and medicinal chemistry contexts.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-12-10(13)6-7-5-8(14-2)3-4-9(7)11/h3-5H,6H2,1-2H3,(H,12,13)
InChI key:InChIKey=CSSDUGGOZLYHIF-UHFFFAOYSA-N
SMILES:C(C(NC)=O)C1=CC(OC)=CC=C1Br
Synonyms:- Benzeneacetamide, 2-bromo-5-methoxy-N-methyl-
- 2-(2-Bromo-5-methoxyphenyl)-N-methylacetamide
- 2-Bromo-5-methoxy-N-methylbenzeneacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.