CAS 1005378-70-0

1-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]propyl]-1H-indole-6-carboxylic acid

Description:

1-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]propyl]-1H-indole-6-carboxylic acid, with CAS number 1005378-70-0, is a synthetic organic compound characterized by its complex structure, which includes an indole ring, a carboxylic acid functional group, and an amino group. This compound features a dimethylethoxycarbonyl group that enhances its stability and solubility in organic solvents. The presence of the indole moiety suggests potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. The carboxylic acid group contributes to its acidity and potential reactivity, making it suitable for various chemical reactions, including esterification and amidation. Additionally, the compound's structure may allow for interactions with biological targets, indicating potential applications in medicinal chemistry. Overall, this compound exemplifies the complexity and versatility of organic molecules in drug development and chemical research.

Formula: C₁₇H₂₂N₂O₄

InChI: InChI=1S/C17H22N2O4/c1-17(2,3)23-16(22)18-8-4-9-19-10-7-12-5-6-13(15(20)21)11-14(12)19/h5-7,10-11H,4,8-9H2,1-3H3,(H,18,22)(H,20,21)

InChI key: InChIKey=WDQHQHXUYHOJMH-UHFFFAOYSA-N

SMILES: C(CCNC(OC(C)(C)C)=O)N1C=2C(C=C1)=CC=C(C(O)=O)C2

Synonyms:

• 1H-Indole-6-carboxylic acid, 1-[3-[[(1,1-dimethylethoxy)carbonyl]amino]propyl]-
• 1-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]propyl]-1H-indole-6-carboxylic acid