CAS 10054-22-5
:5-Oxo-1-tetradecyl-3-pyrrolidinecarboxylic acid
Description:
5-Oxo-1-tetradecyl-3-pyrrolidinecarboxylic acid, with the CAS number 10054-22-5, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a long tetradecyl alkyl chain. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the oxo group indicates a carbonyl functionality, which can influence its chemical behavior and interactions. The tetradecyl chain imparts hydrophobic characteristics, making the compound less soluble in water but more soluble in organic solvents. This amphiphilic nature may allow it to interact with both polar and nonpolar environments, making it of interest in various applications, including surfactants or emulsifiers. Additionally, the pyrrolidine ring can participate in various chemical reactions, potentially leading to the formation of derivatives with diverse biological or industrial applications. Overall, the compound's structural features suggest potential utility in fields such as pharmaceuticals, materials science, and biochemistry.
Formula:C19H35NO3
InChI:InChI=1S/C19H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-20-16-17(19(22)23)15-18(20)21/h17H,2-16H2,1H3,(H,22,23)
InChI key:InChIKey=WCDFDRGOVVEZCN-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)N1CC(C(O)=O)CC1=O
Synonyms:- 3-Pyrrolidinecarboxylic acid, 5-oxo-1-tetradecyl-
- 1-Tetradecyl-5-oxopyrrolidine-3-carboxylic acid
- 5-Oxo-1-tetradecyl-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
