CymitQuimica logo

CAS 1005514-84-0

:

Methyl 3-aminoimidazo[1,5-a]pyridine-6-carboxylate

Description:
Methyl 3-aminoimidazo[1,5-a]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylate ester, which can participate in various chemical reactions, making it a versatile building block in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and carboxylate functional groups. The compound's structure suggests potential biological activity, which has drawn interest in medicinal chemistry for the development of pharmaceuticals. Its molecular interactions can be influenced by the presence of the methyl ester group, which may affect its reactivity and solubility. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings. Overall, Methyl 3-aminoimidazo[1,5-a]pyridine-6-carboxylate is a compound of interest for further research and application in various chemical fields.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-14-8(13)6-2-3-7-4-11-9(10)12(7)5-6/h2-5H,1H3,(H2,10,11)
InChI key:InChIKey=OXIOVRZQQODDCR-UHFFFAOYSA-N
SMILES:NC=1N2C(C=CC(C(OC)=O)=C2)=CN1
Synonyms:
  • Methyl 3-aminoimidazo[1,5-a]pyridine-6-carboxylate
  • Imidazo[1,5-a]pyridine-6-carboxylic acid, 3-amino-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.