CAS 10056-30-1

2,6-dimethyl-4-(3-methylbutyl)morpholine

Description:

2,6-Dimethyl-4-(3-methylbutyl)morpholine is an organic compound characterized by its morpholine ring structure, which consists of a six-membered ring containing both nitrogen and oxygen atoms. This compound features two methyl groups at the 2 and 6 positions and a branched alkyl substituent, specifically a 3-methylbutyl group, at the 4 position of the morpholine ring. The presence of these substituents contributes to its unique physical and chemical properties, including its solubility in organic solvents and potential applications as a solvent or intermediate in chemical synthesis. Morpholines are known for their ability to act as bases and nucleophiles, making this compound potentially useful in various chemical reactions. Additionally, the branched alkyl group may influence its boiling point, melting point, and overall stability. Safety data should be consulted for handling and storage, as morpholine derivatives can exhibit varying degrees of toxicity and environmental impact.

Formula: C₁₁H₂₃NO

InChI: InChI=1/C11H23NO/c1-9(2)5-6-12-7-10(3)13-11(4)8-12/h9-11H,5-8H2,1-4H3

Synonyms:

• Morpholine, 2,6-dimethyl-4-isopentyl-
• Morpholine, 2,6-dimethyl-4-isopentyl-,