CAS 10056-70-9
:Glutamine, 4-fluoro-
Description:
4-Fluoroglutamine, with the CAS number 10056-70-9, is an amino acid derivative characterized by the presence of a fluorine atom at the fourth position of the glutamine molecule. As a non-essential amino acid, glutamine plays a crucial role in various metabolic processes, including protein synthesis and nitrogen transport. The introduction of a fluorine atom can alter the compound's biochemical properties, potentially affecting its interaction with enzymes and receptors. This modification may enhance its stability or influence its solubility in biological systems. 4-Fluoroglutamine is of interest in pharmaceutical research, particularly in the study of metabolic pathways and the development of therapeutic agents. Its structural similarity to natural glutamine allows for the exploration of its effects on cellular functions and its potential applications in cancer research and other metabolic disorders. As with many fluorinated compounds, safety and handling precautions are essential due to the unique properties imparted by the fluorine atom.
Formula:C5H9FN2O3
InChI:InChI=1S/C5H9FN2O3/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H2,8,9)(H,10,11)
InChI key:InChIKey=PGEYFCBAWGQSGT-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)N)(C(N)=O)F
Synonyms:- Glutamine, 4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.