CymitQuimica logo

CAS 1005631-56-0

:

1-(2,2-diethoxyethyl)-4-methyl-1H-pyrazole

Description:
1-(2,2-Diethoxyethyl)-4-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a 2,2-diethoxyethyl substituent, contributing to its unique properties, including increased solubility in organic solvents and potential applications in various chemical reactions. The presence of the methyl group at the 4-position of the pyrazole ring can influence its reactivity and stability. Typically, compounds like this may exhibit moderate to low toxicity, but specific safety data should be consulted for handling and usage. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound's molecular interactions, such as hydrogen bonding and dipole moments, can also play a significant role in its behavior in different environments. As with many organic compounds, proper storage and handling procedures are essential to maintain its integrity and prevent degradation.
Formula:C10H18N2O2
InChI:InChI=1S/C10H18N2O2/c1-4-13-10(14-5-2)8-12-7-9(3)6-11-12/h6-7,10H,4-5,8H2,1-3H3
SMILES:CCOC(Cn1cc(C)cn1)OCC
Synonyms:
  • 1H-Pyrazole, 1-(2,2-diethoxyethyl)-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.