CAS 100564-98-5
:(4R,5S)-2-Oxo-4-(phenylmethyl)-5-oxazolidinecarboxylic acid
Description:
(4R,5S)-2-Oxo-4-(phenylmethyl)-5-oxazolidinecarboxylic acid is a chiral compound characterized by its oxazolidine ring structure, which contributes to its unique stereochemistry and biological activity. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The presence of a phenylmethyl group provides hydrophobic characteristics, potentially affecting its binding affinity to various targets. The specific stereochemistry, indicated by the (4R,5S) configuration, is crucial for its pharmacological properties, as it may dictate how the molecule interacts with enzymes or receptors in biological pathways. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role as an intermediate or active ingredient in drug synthesis. Its unique structural features make it a candidate for further research in areas such as drug design and development, particularly in the context of antibiotic or anti-inflammatory agents.
Formula:C11H11NO4
InChI:InChI=1S/C11H11NO4/c13-10(14)9-8(12-11(15)16-9)6-7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,12,15)(H,13,14)/t8-,9+/m1/s1
InChI key:InChIKey=FBUUHKVPEQLWKF-BDAKNGLRSA-N
SMILES:C([C@@H]1[C@@H](C(O)=O)OC(=O)N1)C2=CC=CC=C2
Synonyms:- (4R,5S)-2-Oxo-4-(phenylmethyl)-5-oxazolidinecarboxylic acid
- 5-Oxazolidinecarboxylic acid, 2-oxo-4-(phenylmethyl)-, (4R-trans)-
- 5-Oxazolidinecarboxylic acid, 2-oxo-4-(phenylmethyl)-, (4R,5S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
