CAS 10057-05-3: Propanoic acid, 2-(3-iodophenoxy)-, (R)-

Description:Propanoic acid, 2-(3-iodophenoxy)-, (R)-, with the CAS number 10057-05-3, is an organic compound characterized by its propanoic acid backbone and a 3-iodophenoxy substituent. This compound features a chiral center, which contributes to its (R)- configuration, indicating its specific spatial arrangement. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the iodine atom in the phenoxy group can influence its reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. Propanoic acid derivatives are known for their role in organic synthesis and can exhibit antimicrobial properties. The compound is soluble in organic solvents and may have limited solubility in water due to the hydrophobic nature of the phenoxy group. As with many organic acids, it may exhibit acidic behavior, capable of donating protons in solution. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.

Formula:C₉H₉IO₃

InChI:InChI=1S/C9H9IO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12)/t6-/m1/s1

InChI key:InChIKey=ZVSVOTPWXYCJTP-ZCFIWIBFSA-N

SMILES:O=C(O)C(OC=1C=CC=C(I)C1)C