CAS 10057-46-2

5-TRIFLUOROMETHYL-1H-BENZOIMIDAZOL-2-YLAMINE

Description:

5-Trifluoromethyl-1H-benzimidazol-2-ylamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a trifluoromethyl group and an amino group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmaceuticals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the amino group may contribute to hydrogen bonding capabilities, affecting solubility and stability in different environments. This compound is of interest in medicinal chemistry and may be explored for its potential applications in drug development, particularly in areas related to antifungal or anticancer therapies. As with many fluorinated compounds, it may also exhibit unique physical and chemical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₈H₆F₃N₃

InChI: InChI=1/C8H6F3N3/c9-8(10,11)4-1-2-5-6(3-4)14-7(12)13-5/h1-3H,(H3,12,13,14)

SMILES: c1cc2c(cc1C(F)(F)F)[nH]c(=N)[nH]2

Synonyms:

• 5-Trifluoromethyl-1H-Benzimidazole-2-Amine
• 6-(trifluoromethyl)-1H-benzimidazol-2-amine

1H-Benzimidazol-2-amine, 6-(trifluoromethyl)-

CAS: 10057-46-2

Formula: C₈H₆F₃N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.1485

Ref: IN-DA0002DE

2-Amino-5-(trifluoromethyl)-1H-benzimidazole

CAS: 10057-46-2

2-Amino-5-(trifluoromethyl)-1H-benzimidazole

Purity: 95

Molecular weight: 201.15g/mol

Ref: 54-PC7729

6-(Trifluoromethyl)-1H-benzo[d]imidazol-2-amine

CAS: 10057-46-2

Formula: C₈H₆F₃N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.152

Ref: 10-F233313