CAS 1005785-63-6

Imidazo[1,2-a]pyridin-2-amine, 6-fluoro-

Description:

Imidazo[1,2-a]pyridin-2-amine, 6-fluoro- is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 6-position of the pyridine ring enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate to high solubility in organic solvents and may have varying solubility in water, depending on the specific conditions. Its structure allows for potential interactions with biological targets, which is significant in drug development. The amine functional group can participate in hydrogen bonding, further influencing its reactivity and interactions. Additionally, the compound may exhibit fluorescence properties due to its aromatic structure, which can be useful in various analytical applications. Overall, Imidazo[1,2-a]pyridin-2-amine, 6-fluoro- is a compound of interest for research in pharmacology and materials science due to its distinctive structural features and potential applications.

Formula: C₇H₆FN₃

InChI: InChI=1S/C7H6FN3/c8-5-1-2-7-10-6(9)4-11(7)3-5/h1-4H,9H2

Synonyms:

• 6-fluoroH-imidazo[1,2-a]pyridin-2-amine
• 6-Fluoroimidazo[1,2-a]pyridin-2-amine