CAS 100587-91-5
:Acetic acid, samarium(3+) salt, hydrate (3:1:?)
Description:
Acetic acid, samarium(3+) salt, hydrate (3:1:?) is a coordination compound formed from samarium ions and acetic acid, typically exhibiting a hydrated crystalline structure. The compound features samarium in a +3 oxidation state, which is a common oxidation state for lanthanide elements. The presence of acetic acid suggests that the compound may exhibit properties associated with both organic and inorganic chemistry, including potential solubility in polar solvents. The hydrate form indicates that water molecules are integrated into the crystal lattice, which can influence the compound's stability, reactivity, and solubility. Such compounds are often studied for their potential applications in materials science, catalysis, and as precursors in the synthesis of other samarium-containing materials. Additionally, the unique electronic and magnetic properties of samarium make these compounds of interest in various fields, including solid-state physics and medicinal chemistry. However, specific characteristics such as melting point, solubility, and reactivity would require empirical data for precise evaluation.
Formula:C2H4O2·xH2OSm
InChI:InChI=1S/C2H4O2.H2O.Sm/c1-2(3)4;;/h1H3,(H,3,4);1H2;
InChI key:InChIKey=NIIXPCRAYFYVGV-UHFFFAOYSA-N
SMILES:C(C)(O)=O.O.[Sm]
Synonyms:- Acetic acid, samarium(3+) salt, hydrate
- Acetic acid, samarium(3+) salt, hydrate (3:1:?)
- Samarium - Acetic Acid (1:1) Hydrate
- Samarium acetate hydrate
- Samarium triacetate hydrate
- Samarium(3+) Triacetate
- Samarium(III) acetate
- Samariumacetate
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery