
CAS 100595-17-3
:9H-Indeno[2,1-c]pyridazine
Description:
9H-Indeno[2,1-c]pyridazine is a heterocyclic organic compound characterized by its fused indene and pyridazine rings. This compound features a bicyclic structure, which contributes to its unique chemical properties and potential applications in various fields, including pharmaceuticals and materials science. It typically exhibits a planar configuration, enhancing its ability to participate in π-π stacking interactions, which can be beneficial in organic electronic applications. The presence of nitrogen in the pyridazine ring introduces basicity and potential reactivity, making it a candidate for further functionalization. Additionally, 9H-Indeno[2,1-c]pyridazine may display interesting photophysical properties, such as fluorescence, which can be exploited in dye applications. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical uses. Overall, this compound's unique structural features and properties make it a subject of interest in synthetic chemistry and material development.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c1-2-4-9-8(3-1)7-11-10(9)5-6-12-13-11/h1-6H,7H2
InChI key:InChIKey=STGMORHGPQLXMT-UHFFFAOYSA-N
SMILES:C1=2C=3C(CC1=CC=CC2)=NN=CC3
Synonyms:- 9H-Indeno[2,1-c]pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
